C14H22F3N5O9S — CID 118237153
[(2S,5R)-2-[[(2S,4R)-4-aminopyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate;2,2,2-trifluoroacetic acid (PubChem CID 118237153) has the molecular formula C14H22F3N5O9S and a molecular weight of 493.42 g/mol. Its IUPAC name is [(2S,5R)-2-[[(2S,4R)-4-aminopyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate;2,2,2-trifluoroacetic acid.
| Compound Name | [(2S,5R)-2-[[(2S,4R)-4-aminopyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118237153 |
| Molecular Formula | C14H22F3N5O9S |
| Molecular Weight | 493.42 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | [(2S,5R)-2-[[(2S,4R)-4-aminopyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate;2,2,2-trifluoroacetic acid |
| SMILES | N[C@H]1CN[C@H](CONC(=O)[C@@H]2CC[C@@H]3CN2C(=O)N3OS(=O)(=O)O)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H21N5O7S.C2HF3O2/c13-7-3-8(14-4-7)6-23-15-11(18)10-2-1-9-5-16(10)12(19)17(9)24-25(20,21)22;3-2(4,5)1(6)7/h7-10,14H,1-6,13H2,(H,15,18)(H,20,21,22);(H,6,7)/t7-,8+,9-,10+;/m1./s1 |
| InChIKey | QABYDALCIILOBQ-LFVXCSCNSA-N |
| XLogP | -1.64 |
| TPSA | 200.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.42 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|