C13H24N4O7S — CID 144851406
[(5R)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate;N-[[(2S)-pyrrolidin-2-yl]methoxy]acetamide (PubChem CID 144851406) has the molecular formula C13H24N4O7S and a molecular weight of 380.42 g/mol. Its IUPAC name is [(5R)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate;N-[[(2S)-pyrrolidin-2-yl]methoxy]acetamide.
| Compound Name | [(5R)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate;N-[[(2S)-pyrrolidin-2-yl]methoxy]acetamide |
|---|---|
| PubChem CID | 144851406 |
| Molecular Formula | C13H24N4O7S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | [(5R)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate;N-[[(2S)-pyrrolidin-2-yl]methoxy]acetamide |
| SMILES | CC(=O)NOC[C@@H]1CCCN1.O=C1N2CCC[C@H](C2)N1OS(=O)(=O)O |
| InChI | InChI=1S/C7H14N2O2.C6H10N2O5S/c1-6(10)9-11-5-7-3-2-4-8-7;9-6-7-3-1-2-5(4-7)8(6)13-14(10,11)12/h7-8H,2-5H2,1H3,(H,9,10);5H,1-4H2,(H,10,11,12)/t7-;5-/m01/s1 |
| InChIKey | ACJSSDIWKBWZKL-SVDSQAGZSA-N |
| XLogP | -0.57 |
| TPSA | 137.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|