C14H27N5O7S — CID 145126250
(7-methyl-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate;N-(pyrrolidin-2-ylmethoxycarbamoyl)formamide (PubChem CID 145126250) has the molecular formula C14H27N5O7S and a molecular weight of 409.47 g/mol. Its IUPAC name is (7-methyl-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate;N-(pyrrolidin-2-ylmethoxycarbamoyl)formamide.
| Compound Name | (7-methyl-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate;N-(pyrrolidin-2-ylmethoxycarbamoyl)formamide |
|---|---|
| PubChem CID | 145126250 |
| Molecular Formula | C14H27N5O7S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | (7-methyl-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate;N-(pyrrolidin-2-ylmethoxycarbamoyl)formamide |
| SMILES | CC1N2CCCC(C2)N1OS(=O)(=O)O.O=CNC(=O)NOCC1CCCN1 |
| InChI | InChI=1S/C7H13N3O3.C7H14N2O4S/c11-5-9-7(12)10-13-4-6-2-1-3-8-6;1-6-8-4-2-3-7(5-8)9(6)13-14(10,11)12/h5-6,8H,1-4H2,(H2,9,10,11,12);6-7H,2-5H2,1H3,(H,10,11,12) |
| InChIKey | DNHXLLBKLMKSNA-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 149.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|