C14H26N4O5S — CID 134561170
[2-[[(1-ethylpiperidin-4-yl)amino]methyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 134561170) has the molecular formula C14H26N4O5S and a molecular weight of 362.45 g/mol. Its IUPAC name is [2-[[(1-ethylpiperidin-4-yl)amino]methyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [2-[[(1-ethylpiperidin-4-yl)amino]methyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 134561170 |
| Molecular Formula | C14H26N4O5S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | [2-[[(1-ethylpiperidin-4-yl)amino]methyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | CCN1CCC(NCC2CCC3CN2C(=O)N3OS(=O)(=O)O)CC1 |
| InChI | InChI=1S/C14H26N4O5S/c1-2-16-7-5-11(6-8-16)15-9-12-3-4-13-10-17(12)14(19)18(13)23-24(20,21)22/h11-13,15H,2-10H2,1H3,(H,20,21,22) |
| InChIKey | ULKINJGFPDOCCP-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|