C15H32N4O6S — CID 143835638
N-(1-aminopropan-2-yl)-N-propylformamide;ethane;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate (PubChem CID 143835638) has the molecular formula C15H32N4O6S and a molecular weight of 396.51 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-N-propylformamide;ethane;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate.
| Compound Name | N-(1-aminopropan-2-yl)-N-propylformamide;ethane;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate |
|---|---|
| PubChem CID | 143835638 |
| Molecular Formula | C15H32N4O6S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N-(1-aminopropan-2-yl)-N-propylformamide;ethane;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate |
| SMILES | CC.CCCN(C=O)C(C)CN.O=C1N2CCCC(C2)N1OS(=O)(=O)O |
| InChI | InChI=1S/C7H16N2O.C6H10N2O5S.C2H6/c1-3-4-9(6-10)7(2)5-8;9-6-7-3-1-2-5(4-7)8(6)13-14(10,11)12;1-2/h6-7H,3-5,8H2,1-2H3;5H,1-4H2,(H,10,11,12);1-2H3 |
| InChIKey | QHHRDKROUGVEOR-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 133.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|