C7H11N3O6S — CID 126557514
[(2S,5R)-2-formamido-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 126557514) has the molecular formula C7H11N3O6S and a molecular weight of 265.25 g/mol. Its IUPAC name is [(2S,5R)-2-formamido-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-formamido-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 126557514 |
| Molecular Formula | C7H11N3O6S |
| Molecular Weight | 265.25 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | [(2S,5R)-2-formamido-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=CN[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C7H11N3O6S/c11-4-8-6-2-1-5-3-9(6)7(12)10(5)16-17(13,14)15/h4-6H,1-3H2,(H,8,11)(H,13,14,15)/t5-,6+/m1/s1 |
| InChIKey | NJGYTPGPCDVTLB-RITPCOANSA-N |
| XLogP | -1.31 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.25 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|