C12H24N4O5S2 — CID 142418302
N-methoxyformamide;pyrrolidine;6-sulfanyloxysulfanyloxy-1,6-diazabicyclo[3.2.1]octan-7-one (PubChem CID 142418302) has the molecular formula C12H24N4O5S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is N-methoxyformamide;pyrrolidine;6-sulfanyloxysulfanyloxy-1,6-diazabicyclo[3.2.1]octan-7-one.
| Compound Name | N-methoxyformamide;pyrrolidine;6-sulfanyloxysulfanyloxy-1,6-diazabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 142418302 |
| Molecular Formula | C12H24N4O5S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | N-methoxyformamide;pyrrolidine;6-sulfanyloxysulfanyloxy-1,6-diazabicyclo[3.2.1]octan-7-one |
| SMILES | C1CCNC1.CONC=O.O=C1N2CCCC(C2)N1OSOS |
| InChI | InChI=1S/C6H10N2O3S2.C4H9N.C2H5NO2/c9-6-7-3-1-2-5(4-7)8(6)10-13-11-12;1-2-4-5-3-1;1-5-3-2-4/h5,12H,1-4H2;5H,1-4H2;2H,1H3,(H,3,4) |
| InChIKey | CSPKHIUXUXCMSI-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|