C23H46N4O6S — CID 169492883
[(2S,5R)-2-formamido-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate;tetrabutylazanium (PubChem CID 169492883) has the molecular formula C23H46N4O6S and a molecular weight of 506.71 g/mol. Its IUPAC name is [(2S,5R)-2-formamido-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate;tetrabutylazanium.
| Compound Name | [(2S,5R)-2-formamido-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate;tetrabutylazanium |
|---|---|
| PubChem CID | 169492883 |
| Molecular Formula | C23H46N4O6S |
| Molecular Weight | 506.71 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | [(2S,5R)-2-formamido-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=CN[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)[O-] |
| InChI | InChI=1S/C16H36N.C7H11N3O6S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;11-4-8-6-2-1-5-3-9(6)7(12)10(5)16-17(13,14)15/h5-16H2,1-4H3;4-6H,1-3H2,(H,8,11)(H,13,14,15)/q+1;/p-1/t;5-,6+/m.1/s1 |
| InChIKey | NCUYAGKKBFGTOB-BCBTXJGPSA-M |
| XLogP | 3.35 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.71 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|