C10H20N4O7S — CID 144827231
N-(3-aminopropoxy)formamide;[(5R)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 144827231) has the molecular formula C10H20N4O7S and a molecular weight of 340.36 g/mol. Its IUPAC name is N-(3-aminopropoxy)formamide;[(5R)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | N-(3-aminopropoxy)formamide;[(5R)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 144827231 |
| Molecular Formula | C10H20N4O7S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | N-(3-aminopropoxy)formamide;[(5R)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | NCCCONC=O.O=C1N2CCC[C@H](C2)N1OS(=O)(=O)O |
| InChI | InChI=1S/C6H10N2O5S.C4H10N2O2/c9-6-7-3-1-2-5(4-7)8(6)13-14(10,11)12;5-2-1-3-8-6-4-7/h5H,1-4H2,(H,10,11,12);4H,1-3,5H2,(H,6,7)/t5-;/m1./s1 |
| InChIKey | FGUOTZDGDSRKJT-NUBCRITNSA-N |
| XLogP | -1.37 |
| TPSA | 151.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|