C10H21N4O3P — CID 144827236
N-(3-aminopropoxy)formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one (PubChem CID 144827236) has the molecular formula C10H21N4O3P and a molecular weight of 276.28 g/mol. Its IUPAC name is N-(3-aminopropoxy)formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one.
| Compound Name | N-(3-aminopropoxy)formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 144827236 |
| Molecular Formula | C10H21N4O3P |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | N-(3-aminopropoxy)formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one |
| SMILES | NCCCONC=O.O=C1N2CCCC(C2)N1P |
| InChI | InChI=1S/C6H11N2OP.C4H10N2O2/c9-6-7-3-1-2-5(4-7)8(6)10;5-2-1-3-8-6-4-7/h5H,1-4,10H2;4H,1-3,5H2,(H,6,7) |
| InChIKey | BFRMEGKTCRENOO-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|