C12H28N4O3P2 — CID 144827240
ethane;N-[2-[methyl(phosphanyl)amino]ethoxy]formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one (PubChem CID 144827240) has the molecular formula C12H28N4O3P2 and a molecular weight of 338.33 g/mol. Its IUPAC name is ethane;N-[2-[methyl(phosphanyl)amino]ethoxy]formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one.
| Compound Name | ethane;N-[2-[methyl(phosphanyl)amino]ethoxy]formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 144827240 |
| Molecular Formula | C12H28N4O3P2 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | ethane;N-[2-[methyl(phosphanyl)amino]ethoxy]formamide;6-phosphanyl-1,6-diazabicyclo[3.2.1]octan-7-one |
| SMILES | CC.CN(P)CCONC=O.O=C1N2CCCC(C2)N1P |
| InChI | InChI=1S/C6H11N2OP.C4H11N2O2P.C2H6/c9-6-7-3-1-2-5(4-7)8(6)10;1-6(9)2-3-8-5-4-7;1-2/h5H,1-4,10H2;4H,2-3,9H2,1H3,(H,5,7);1-2H3 |
| InChIKey | ZLIVAVZEISBCMJ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|