C14H30N4O6S — CID 144957255
ethane;(3-ethyl-2-oxo-1,3-diazinan-1-yl) hydrogen sulfate;N-piperidin-4-ylformamide (PubChem CID 144957255) has the molecular formula C14H30N4O6S and a molecular weight of 382.48 g/mol. Its IUPAC name is ethane;(3-ethyl-2-oxo-1,3-diazinan-1-yl) hydrogen sulfate;N-piperidin-4-ylformamide.
| Compound Name | ethane;(3-ethyl-2-oxo-1,3-diazinan-1-yl) hydrogen sulfate;N-piperidin-4-ylformamide |
|---|---|
| PubChem CID | 144957255 |
| Molecular Formula | C14H30N4O6S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | ethane;(3-ethyl-2-oxo-1,3-diazinan-1-yl) hydrogen sulfate;N-piperidin-4-ylformamide |
| SMILES | CC.CCN1CCCN(OS(=O)(=O)O)C1=O.O=CNC1CCNCC1 |
| InChI | InChI=1S/C6H12N2O5S.C6H12N2O.C2H6/c1-2-7-4-3-5-8(6(7)9)13-14(10,11)12;9-5-8-6-1-3-7-4-2-6;1-2/h2-5H2,1H3,(H,10,11,12);5-7H,1-4H2,(H,8,9);1-2H3 |
| InChIKey | HGKRUUJQUHUAPY-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|