C9H14F3N3S — CID 121378930
N',N'-dimethyl-N-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]ethane-1,2-diamine (PubChem CID 121378930) has the molecular formula C9H14F3N3S and a molecular weight of 253.29 g/mol. Its IUPAC name is N',N'-dimethyl-N-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 121378930 |
| Molecular Formula | C9H14F3N3S |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | N',N'-dimethyl-N-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]ethane-1,2-diamine |
| SMILES | CN(C)CCNCc1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C9H14F3N3S/c1-15(2)4-3-13-5-7-6-14-8(16-7)9(10,11)12/h6,13H,3-5H2,1-2H3 |
| InChIKey | PXOFYYNLZIDJAR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|