C6H10N2S — CID 60983127
(2-ethyl-1,3-thiazol-5-yl)methanamine (PubChem CID 60983127) has the molecular formula C6H10N2S and a molecular weight of 142.23 g/mol. Its IUPAC name is (2-ethyl-1,3-thiazol-5-yl)methanamine.
| Compound Name | (2-ethyl-1,3-thiazol-5-yl)methanamine |
|---|---|
| PubChem CID | 60983127 |
| Molecular Formula | C6H10N2S |
| Molecular Weight | 142.23 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | (2-ethyl-1,3-thiazol-5-yl)methanamine |
| SMILES | CCc1ncc(CN)s1 |
| InChI | InChI=1S/C6H10N2S/c1-2-6-8-4-5(3-7)9-6/h4H,2-3,7H2,1H3 |
| InChIKey | VVGHFFICVOVLNB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |