C17H16F2N4O — CID 121379409
7-[(2,6-difluorophenyl)methoxy]-2,5-dimethylpyrazolo[1,5-a]pyridine-3-carboximidamide (PubChem CID 121379409) has the molecular formula C17H16F2N4O and a molecular weight of 330.34 g/mol. Its IUPAC name is 7-[(2,6-difluorophenyl)methoxy]-2,5-dimethylpyrazolo[1,5-a]pyridine-3-carboximidamide.
| Compound Name | 7-[(2,6-difluorophenyl)methoxy]-2,5-dimethylpyrazolo[1,5-a]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 121379409 |
| Molecular Formula | C17H16F2N4O |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 7-[(2,6-difluorophenyl)methoxy]-2,5-dimethylpyrazolo[1,5-a]pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(C)nn2c(OCc3c(F)cccc3F)cc(C)cc12 |
| InChI | InChI=1S/C17H16F2N4O/c1-9-6-14-16(17(20)21)10(2)22-23(14)15(7-9)24-8-11-12(18)4-3-5-13(11)19/h3-7H,8H2,1-2H3,(H3,20,21) |
| InChIKey | KVJILOJJOJCWOJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|