C29H27F5N4O4 — CID 130234397
7-[(2,6-difluorophenyl)methoxy]-2,5-dimethyl-N-(1-methyl-3,4-dihydro-2H-quinolin-4-yl)pyrazolo[1,5-a]pyridine-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 130234397) has the molecular formula C29H27F5N4O4 and a molecular weight of 590.55 g/mol. Its IUPAC name is 7-[(2,6-difluorophenyl)methoxy]-2,5-dimethyl-N-(1-methyl-3,4-dihydro-2H-quinolin-4-yl)pyrazolo[1,5-a]pyridine-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 7-[(2,6-difluorophenyl)methoxy]-2,5-dimethyl-N-(1-methyl-3,4-dihydro-2H-quinolin-4-yl)pyrazolo[1,5-a]pyridine-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 130234397 |
| Molecular Formula | C29H27F5N4O4 |
| Molecular Weight | 590.55 g/mol |
| Exact Mass | 590.20 |
| IUPAC Name | 7-[(2,6-difluorophenyl)methoxy]-2,5-dimethyl-N-(1-methyl-3,4-dihydro-2H-quinolin-4-yl)pyrazolo[1,5-a]pyridine-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(OCc2c(F)cccc2F)n2nc(C)c(C(=O)NC3CCN(C)c4ccccc43)c2c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H26F2N4O2.C2HF3O2/c1-16-13-24-26(27(34)30-22-11-12-32(3)23-10-5-4-7-18(22)23)17(2)31-33(24)25(14-16)35-15-19-20(28)8-6-9-21(19)29;3-2(4,5)1(6)7/h4-10,13-14,22H,11-12,15H2,1-3H3,(H,30,34);(H,6,7) |
| InChIKey | KLXNOHLSIUCASB-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.55 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |