C24H19F3N6O2 — CID 121380490
4-[5-(2-methoxyethyl)-4-oxo-8-[3-(trifluoromethyl)phenyl]-1,5,8,10,12-pentazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-2-yl]benzonitrile (PubChem CID 121380490) has the molecular formula C24H19F3N6O2 and a molecular weight of 480.45 g/mol. Its IUPAC name is 4-[5-(2-methoxyethyl)-4-oxo-8-[3-(trifluoromethyl)phenyl]-1,5,8,10,12-pentazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-2-yl]benzonitrile.
| Compound Name | 4-[5-(2-methoxyethyl)-4-oxo-8-[3-(trifluoromethyl)phenyl]-1,5,8,10,12-pentazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-2-yl]benzonitrile |
|---|---|
| PubChem CID | 121380490 |
| Molecular Formula | C24H19F3N6O2 |
| Molecular Weight | 480.45 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 4-[5-(2-methoxyethyl)-4-oxo-8-[3-(trifluoromethyl)phenyl]-1,5,8,10,12-pentazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-2-yl]benzonitrile |
| SMILES | COCCN1CC2=C(C1=O)C(c1ccc(C#N)cc1)n1ncnc1N2c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H19F3N6O2/c1-35-10-9-31-13-19-20(22(31)34)21(16-7-5-15(12-28)6-8-16)33-23(29-14-30-33)32(19)18-4-2-3-17(11-18)24(25,26)27/h2-8,11,14,21H,9-10,13H2,1H3 |
| InChIKey | UMMGIGYKDYKUDA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 87.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |