C23H21F3N6O2 — CID 91041780
5-(2-methoxyethyl)-2-(4-methylphenyl)-8-[3-(trifluoromethyl)phenyl]-1,5,8,10,11,12-hexazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-4-one (PubChem CID 91041780) has the molecular formula C23H21F3N6O2 and a molecular weight of 470.46 g/mol. Its IUPAC name is 5-(2-methoxyethyl)-2-(4-methylphenyl)-8-[3-(trifluoromethyl)phenyl]-1,5,8,10,11,12-hexazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-4-one.
| Compound Name | 5-(2-methoxyethyl)-2-(4-methylphenyl)-8-[3-(trifluoromethyl)phenyl]-1,5,8,10,11,12-hexazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-4-one |
|---|---|
| PubChem CID | 91041780 |
| Molecular Formula | C23H21F3N6O2 |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 5-(2-methoxyethyl)-2-(4-methylphenyl)-8-[3-(trifluoromethyl)phenyl]-1,5,8,10,11,12-hexazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-4-one |
| SMILES | COCCN1CC2=C(C1=O)C(c1ccc(C)cc1)n1nnnc1N2c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H21F3N6O2/c1-14-6-8-15(9-7-14)20-19-18(13-30(21(19)33)10-11-34-2)31(22-27-28-29-32(20)22)17-5-3-4-16(12-17)23(24,25)26/h3-9,12,20H,10-11,13H2,1-2H3 |
| InChIKey | NCKCLQJTWXSVDI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |