C13H17FN2O3 — CID 121380740
4-[2-(fluoromethyl)-6-(2-hydroxyethyl)pyrimidin-4-yl]oxycyclohexan-1-one (PubChem CID 121380740) has the molecular formula C13H17FN2O3 and a molecular weight of 268.29 g/mol. Its IUPAC name is 4-[2-(fluoromethyl)-6-(2-hydroxyethyl)pyrimidin-4-yl]oxycyclohexan-1-one.
| Compound Name | 4-[2-(fluoromethyl)-6-(2-hydroxyethyl)pyrimidin-4-yl]oxycyclohexan-1-one |
|---|---|
| PubChem CID | 121380740 |
| Molecular Formula | C13H17FN2O3 |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 4-[2-(fluoromethyl)-6-(2-hydroxyethyl)pyrimidin-4-yl]oxycyclohexan-1-one |
| SMILES | O=C1CCC(Oc2cc(CCO)nc(CF)n2)CC1 |
| InChI | InChI=1S/C13H17FN2O3/c14-8-12-15-9(5-6-17)7-13(16-12)19-11-3-1-10(18)2-4-11/h7,11,17H,1-6,8H2 |
| InChIKey | SODZDIYQKMDJIY-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |