C15H19F3N2O2 — CID 71263741
4-[6-[(2R)-butan-2-yl]-2-(trifluoromethyl)pyrimidin-4-yl]oxycyclohexan-1-one (PubChem CID 71263741) has the molecular formula C15H19F3N2O2 and a molecular weight of 316.32 g/mol. Its IUPAC name is 4-[6-[(2R)-butan-2-yl]-2-(trifluoromethyl)pyrimidin-4-yl]oxycyclohexan-1-one.
| Compound Name | 4-[6-[(2R)-butan-2-yl]-2-(trifluoromethyl)pyrimidin-4-yl]oxycyclohexan-1-one |
|---|---|
| PubChem CID | 71263741 |
| Molecular Formula | C15H19F3N2O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 4-[6-[(2R)-butan-2-yl]-2-(trifluoromethyl)pyrimidin-4-yl]oxycyclohexan-1-one |
| SMILES | CC[C@@H](C)c1cc(OC2CCC(=O)CC2)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C15H19F3N2O2/c1-3-9(2)12-8-13(20-14(19-12)15(16,17)18)22-11-6-4-10(21)5-7-11/h8-9,11H,3-7H2,1-2H3/t9-/m1/s1 |
| InChIKey | LOXYQUSWMLYRNF-SECBINFHSA-N |
| XLogP | 3.90 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |