C23H27FN2O3 — CID 121382012
N-(3-tert-butylphenyl)-1-(2-fluoro-6-hydroxybenzoyl)piperidine-3-carboxamide (PubChem CID 121382012) has the molecular formula C23H27FN2O3 and a molecular weight of 398.48 g/mol. Its IUPAC name is N-(3-tert-butylphenyl)-1-(2-fluoro-6-hydroxybenzoyl)piperidine-3-carboxamide.
| Compound Name | N-(3-tert-butylphenyl)-1-(2-fluoro-6-hydroxybenzoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 121382012 |
| Molecular Formula | C23H27FN2O3 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | N-(3-tert-butylphenyl)-1-(2-fluoro-6-hydroxybenzoyl)piperidine-3-carboxamide |
| SMILES | CC(C)(C)c1cccc(NC(=O)C2CCCN(C(=O)c3c(O)cccc3F)C2)c1 |
| InChI | InChI=1S/C23H27FN2O3/c1-23(2,3)16-8-4-9-17(13-16)25-21(28)15-7-6-12-26(14-15)22(29)20-18(24)10-5-11-19(20)27/h4-5,8-11,13,15,27H,6-7,12,14H2,1-3H3,(H,25,28) |
| InChIKey | PWTYCDPZHVTNPF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |