C25H30FN3O2 — CID 129074399
(3S)-1-(2-fluoro-6-methylbenzoyl)-N-(3-piperidin-1-ylphenyl)piperidine-3-carboxamide (PubChem CID 129074399) has the molecular formula C25H30FN3O2 and a molecular weight of 423.53 g/mol. Its IUPAC name is (3S)-1-(2-fluoro-6-methylbenzoyl)-N-(3-piperidin-1-ylphenyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-(2-fluoro-6-methylbenzoyl)-N-(3-piperidin-1-ylphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 129074399 |
| Molecular Formula | C25H30FN3O2 |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | (3S)-1-(2-fluoro-6-methylbenzoyl)-N-(3-piperidin-1-ylphenyl)piperidine-3-carboxamide |
| SMILES | Cc1cccc(F)c1C(=O)N1CCC[C@H](C(=O)Nc2cccc(N3CCCCC3)c2)C1 |
| InChI | InChI=1S/C25H30FN3O2/c1-18-8-5-12-22(26)23(18)25(31)29-15-7-9-19(17-29)24(30)27-20-10-6-11-21(16-20)28-13-3-2-4-14-28/h5-6,8,10-12,16,19H,2-4,7,9,13-15,17H2,1H3,(H,27,30)/t19-/m0/s1 |
| InChIKey | QAGIOLDXZXJEIP-IBGZPJMESA-N |
| XLogP | 4.62 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |