C34H40FN3O2 — CID 147838203
(3S)-N-(3-tert-butylphenyl)-1-(2-fluoro-6-methylbenzoyl)-2-(4-pyrrolidin-1-ylphenyl)piperidine-3-carboxamide (PubChem CID 147838203) has the molecular formula C34H40FN3O2 and a molecular weight of 541.71 g/mol. Its IUPAC name is (3S)-N-(3-tert-butylphenyl)-1-(2-fluoro-6-methylbenzoyl)-2-(4-pyrrolidin-1-ylphenyl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-(3-tert-butylphenyl)-1-(2-fluoro-6-methylbenzoyl)-2-(4-pyrrolidin-1-ylphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 147838203 |
| Molecular Formula | C34H40FN3O2 |
| Molecular Weight | 541.71 g/mol |
| Exact Mass | 541.31 |
| IUPAC Name | (3S)-N-(3-tert-butylphenyl)-1-(2-fluoro-6-methylbenzoyl)-2-(4-pyrrolidin-1-ylphenyl)piperidine-3-carboxamide |
| SMILES | Cc1cccc(F)c1C(=O)N1CCC[C@H](C(=O)Nc2cccc(C(C)(C)C)c2)C1c1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C34H40FN3O2/c1-23-10-7-14-29(35)30(23)33(40)38-21-9-13-28(32(39)36-26-12-8-11-25(22-26)34(2,3)4)31(38)24-15-17-27(18-16-24)37-19-5-6-20-37/h7-8,10-12,14-18,22,28,31H,5-6,9,13,19-21H2,1-4H3,(H,36,39)/t28-,31?/m0/s1 |
| InChIKey | HSLBIKMPNZPTRX-NPHAVVRNSA-N |
| XLogP | 7.26 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.71 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|