C35H42FN3O2 — CID 138526895
(2R)-N-(3-tert-butylphenyl)-2-[4-[(cyclobutylamino)methyl]phenyl]-1-(2-fluoro-6-methylbenzoyl)piperidine-3-carboxamide (PubChem CID 138526895) has the molecular formula C35H42FN3O2 and a molecular weight of 555.74 g/mol. Its IUPAC name is (2R)-N-(3-tert-butylphenyl)-2-[4-[(cyclobutylamino)methyl]phenyl]-1-(2-fluoro-6-methylbenzoyl)piperidine-3-carboxamide.
| Compound Name | (2R)-N-(3-tert-butylphenyl)-2-[4-[(cyclobutylamino)methyl]phenyl]-1-(2-fluoro-6-methylbenzoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 138526895 |
| Molecular Formula | C35H42FN3O2 |
| Molecular Weight | 555.74 g/mol |
| Exact Mass | 555.33 |
| IUPAC Name | (2R)-N-(3-tert-butylphenyl)-2-[4-[(cyclobutylamino)methyl]phenyl]-1-(2-fluoro-6-methylbenzoyl)piperidine-3-carboxamide |
| SMILES | Cc1cccc(F)c1C(=O)N1CCCC(C(=O)Nc2cccc(C(C)(C)C)c2)[C@@H]1c1ccc(CNC2CCC2)cc1 |
| InChI | InChI=1S/C35H42FN3O2/c1-23-9-5-15-30(36)31(23)34(41)39-20-8-14-29(33(40)38-28-13-6-10-26(21-28)35(2,3)4)32(39)25-18-16-24(17-19-25)22-37-27-11-7-12-27/h5-6,9-10,13,15-19,21,27,29,32,37H,7-8,11-12,14,20,22H2,1-4H3,(H,38,40)/t29?,32-/m0/s1 |
| InChIKey | ZRNGVYWQQRBITK-VQSVVBPOSA-N |
| XLogP | 7.31 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.74 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |