C35H42FN3O3 — CID 147532780
(3S)-N-(3-tert-butylphenyl)-1-(2-fluoro-6-methylbenzoyl)-2-[4-[(2-methyloxolan-3-yl)amino]phenyl]piperidine-3-carboxamide (PubChem CID 147532780) has the molecular formula C35H42FN3O3 and a molecular weight of 571.74 g/mol. Its IUPAC name is (3S)-N-(3-tert-butylphenyl)-1-(2-fluoro-6-methylbenzoyl)-2-[4-[(2-methyloxolan-3-yl)amino]phenyl]piperidine-3-carboxamide.
| Compound Name | (3S)-N-(3-tert-butylphenyl)-1-(2-fluoro-6-methylbenzoyl)-2-[4-[(2-methyloxolan-3-yl)amino]phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 147532780 |
| Molecular Formula | C35H42FN3O3 |
| Molecular Weight | 571.74 g/mol |
| Exact Mass | 571.32 |
| IUPAC Name | (3S)-N-(3-tert-butylphenyl)-1-(2-fluoro-6-methylbenzoyl)-2-[4-[(2-methyloxolan-3-yl)amino]phenyl]piperidine-3-carboxamide |
| SMILES | Cc1cccc(F)c1C(=O)N1CCC[C@H](C(=O)Nc2cccc(C(C)(C)C)c2)C1c1ccc(NC2CCOC2C)cc1 |
| InChI | InChI=1S/C35H42FN3O3/c1-22-9-6-13-29(36)31(22)34(41)39-19-8-12-28(33(40)38-27-11-7-10-25(21-27)35(3,4)5)32(39)24-14-16-26(17-15-24)37-30-18-20-42-23(30)2/h6-7,9-11,13-17,21,23,28,30,32,37H,8,12,18-20H2,1-5H3,(H,38,40)/t23?,28-,30?,32?/m0/s1 |
| InChIKey | FNJMNBNWIDMMDL-FAXUPCBWSA-N |
| XLogP | 7.25 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.74 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |