C30H34N2O2 — CID 149173476
(2R)-N-(3-tert-butylphenyl)-1-(2-methylbenzoyl)-2-phenylpiperidine-3-carboxamide (PubChem CID 149173476) has the molecular formula C30H34N2O2 and a molecular weight of 454.61 g/mol. Its IUPAC name is (2R)-N-(3-tert-butylphenyl)-1-(2-methylbenzoyl)-2-phenylpiperidine-3-carboxamide.
| Compound Name | (2R)-N-(3-tert-butylphenyl)-1-(2-methylbenzoyl)-2-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 149173476 |
| Molecular Formula | C30H34N2O2 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | (2R)-N-(3-tert-butylphenyl)-1-(2-methylbenzoyl)-2-phenylpiperidine-3-carboxamide |
| SMILES | Cc1ccccc1C(=O)N1CCCC(C(=O)Nc2cccc(C(C)(C)C)c2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C30H34N2O2/c1-21-12-8-9-17-25(21)29(34)32-19-11-18-26(27(32)22-13-6-5-7-14-22)28(33)31-24-16-10-15-23(20-24)30(2,3)4/h5-10,12-17,20,26-27H,11,18-19H2,1-4H3,(H,31,33)/t26?,27-/m0/s1 |
| InChIKey | WZNBFROGZCXHHZ-GEVKEYJPSA-N |
| XLogP | 6.52 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |