C32H36ClN3O2 — CID 126669759
(3S)-N-(3-chloro-4-methylphenyl)-2-[4-(cyclopentylamino)phenyl]-1-(2-methylbenzoyl)piperidine-3-carboxamide (PubChem CID 126669759) has the molecular formula C32H36ClN3O2 and a molecular weight of 530.11 g/mol. Its IUPAC name is (3S)-N-(3-chloro-4-methylphenyl)-2-[4-(cyclopentylamino)phenyl]-1-(2-methylbenzoyl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-(3-chloro-4-methylphenyl)-2-[4-(cyclopentylamino)phenyl]-1-(2-methylbenzoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 126669759 |
| Molecular Formula | C32H36ClN3O2 |
| Molecular Weight | 530.11 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | (3S)-N-(3-chloro-4-methylphenyl)-2-[4-(cyclopentylamino)phenyl]-1-(2-methylbenzoyl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@H]2CCCN(C(=O)c3ccccc3C)C2c2ccc(NC3CCCC3)cc2)cc1Cl |
| InChI | InChI=1S/C32H36ClN3O2/c1-21-8-3-6-11-27(21)32(38)36-19-7-12-28(31(37)35-26-16-13-22(2)29(33)20-26)30(36)23-14-17-25(18-15-23)34-24-9-4-5-10-24/h3,6,8,11,13-18,20,24,28,30,34H,4-5,7,9-10,12,19H2,1-2H3,(H,35,37)/t28-,30?/m0/s1 |
| InChIKey | OPSNJGNTYCBZBL-MBCWZBCWSA-N |
| XLogP | 7.54 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.11 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |