C27H29NS — CID 121382363
2,4-bis(4-tert-butylphenyl)thieno[3,2-c]pyridine (PubChem CID 121382363) has the molecular formula C27H29NS and a molecular weight of 399.60 g/mol. Its IUPAC name is 2,4-bis(4-tert-butylphenyl)thieno[3,2-c]pyridine.
| Compound Name | 2,4-bis(4-tert-butylphenyl)thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 121382363 |
| Molecular Formula | C27H29NS |
| Molecular Weight | 399.60 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 2,4-bis(4-tert-butylphenyl)thieno[3,2-c]pyridine |
| SMILES | CC(C)(C)c1ccc(-c2cc3c(-c4ccc(C(C)(C)C)cc4)nccc3s2)cc1 |
| InChI | InChI=1S/C27H29NS/c1-26(2,3)20-11-7-18(8-12-20)24-17-22-23(29-24)15-16-28-25(22)19-9-13-21(14-10-19)27(4,5)6/h7-17H,1-6H3 |
| InChIKey | BYFZOWCFNOTRDX-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.60 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |