C18H18IrNS- — CID 140720785
4-(4-tert-butylbenzene-6-id-1-yl)-2-methylthieno[3,2-c]pyridine;iridium (PubChem CID 140720785) has the molecular formula C18H18IrNS- and a molecular weight of 472.63 g/mol. Its IUPAC name is 4-(4-tert-butylbenzene-6-id-1-yl)-2-methylthieno[3,2-c]pyridine;iridium.
| Compound Name | 4-(4-tert-butylbenzene-6-id-1-yl)-2-methylthieno[3,2-c]pyridine;iridium |
|---|---|
| PubChem CID | 140720785 |
| Molecular Formula | C18H18IrNS- |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | 4-(4-tert-butylbenzene-6-id-1-yl)-2-methylthieno[3,2-c]pyridine;iridium |
| SMILES | Cc1cc2c(-c3[c-]cc(C(C)(C)C)cc3)nccc2s1.[Ir] |
| InChI | InChI=1S/C18H18NS.Ir/c1-12-11-15-16(20-12)9-10-19-17(15)13-5-7-14(8-6-13)18(2,3)4;/h5,7-11H,1-4H3;/q-1; |
| InChIKey | CWCHMLGEYFHSLF-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|