C29H26IrN2O-2 — CID 140788907
4-(4-tert-butylbenzene-6-id-1-yl)furo[3,2-c]pyridine;iridium;2-methyl-6-phenylpyridine (PubChem CID 140788907) has the molecular formula C29H26IrN2O-2 and a molecular weight of 610.76 g/mol. Its IUPAC name is 4-(4-tert-butylbenzene-6-id-1-yl)furo[3,2-c]pyridine;iridium;2-methyl-6-phenylpyridine.
| Compound Name | 4-(4-tert-butylbenzene-6-id-1-yl)furo[3,2-c]pyridine;iridium;2-methyl-6-phenylpyridine |
|---|---|
| PubChem CID | 140788907 |
| Molecular Formula | C29H26IrN2O-2 |
| Molecular Weight | 610.76 g/mol |
| Exact Mass | 611.17 |
| IUPAC Name | 4-(4-tert-butylbenzene-6-id-1-yl)furo[3,2-c]pyridine;iridium;2-methyl-6-phenylpyridine |
| SMILES | CC(C)(C)c1c[c-]c(-c2nccc3occc23)cc1.Cc1cccc(-c2[c-]cccc2)n1.[Ir] |
| InChI | InChI=1S/C17H16NO.C12H10N.Ir/c1-17(2,3)13-6-4-12(5-7-13)16-14-9-11-19-15(14)8-10-18-16;1-10-6-5-9-12(13-10)11-7-3-2-4-8-11;/h4,6-11H,1-3H3;2-7,9H,1H3;/q2*-1; |
| InChIKey | GNZPXPGQMWYLQF-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.76 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|