About 2-tert-butyl-5-(2,4-difluorophenyl)-4-methylpyridine
2-tert-butyl-5-(2,4-difluorophenyl)-4-methylpyridine (PubChem CID 121384487) has the molecular formula C16H17F2N
and a molecular weight of 261.31 g/mol. Its IUPAC name is 2-tert-butyl-5-(2,4-difluorophenyl)-4-methylpyridine.
Molecular Properties
| Compound Name | 2-tert-butyl-5-(2,4-difluorophenyl)-4-methylpyridine |
| PubChem CID | 121384487 |
| Molecular Formula | C16H17F2N |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2-tert-butyl-5-(2,4-difluorophenyl)-4-methylpyridine |
| SMILES | Cc1cc(C(C)(C)C)ncc1-c1ccc(F)cc1F |
| InChI | InChI=1S/C16H17F2N/c1-10-7-15(16(2,3)4)19-9-13(10)12-6-5-11(17)8-14(12)18/h5-9H,1-4H3 |
| InChIKey | JZCZFQNJIJNPNN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-tert-butyl-5-(2,4-difluorophenyl)-4-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-5-(2,4-difluorophenyl)-4-methylpyridine?
The IUPAC name of 2-tert-butyl-5-(2,4-difluorophenyl)-4-methylpyridine (CID 121384487) is 2-tert-butyl-5-(2,4-difluorophenyl)-4-methylpyridine.
What is the SMILES notation for 2-tert-butyl-5-(2,4-difluorophenyl)-4-methylpyridine?
The canonical SMILES for 2-tert-butyl-5-(2,4-difluorophenyl)-4-methylpyridine is Cc1cc(C(C)(C)C)ncc1-c1ccc(F)cc1F.
What is the InChIKey of 2-tert-butyl-5-(2,4-difluorophenyl)-4-methylpyridine?
The InChIKey is JZCZFQNJIJNPNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F2N/c1-10-7-15(16(2,3)4)19-9-13(10)12-6-5-11(17)8-14(12)18/h5-9H,1-4H3.
What are the key properties of 2-tert-butyl-5-(2,4-difluorophenyl)-4-methylpyridine?
2-tert-butyl-5-(2,4-difluorophenyl)-4-methylpyridine has a molecular weight of 261.31 g/mol, XLogP of 4.63, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5-(2,4-difluorophenyl)-4-methylpyridine is sourced from PubChem (CID 121384487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).