C11H8FNS — CID 121385599
6-fluoro-2-methyl-4H-thieno[3,2-b]indole (PubChem CID 121385599) has the molecular formula C11H8FNS and a molecular weight of 205.26 g/mol. Its IUPAC name is 6-fluoro-2-methyl-4H-thieno[3,2-b]indole.
| Compound Name | 6-fluoro-2-methyl-4H-thieno[3,2-b]indole |
|---|---|
| PubChem CID | 121385599 |
| Molecular Formula | C11H8FNS |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 6-fluoro-2-methyl-4H-thieno[3,2-b]indole |
| SMILES | Cc1cc2[nH]c3cc(F)ccc3c2s1 |
| InChI | InChI=1S/C11H8FNS/c1-6-4-10-11(14-6)8-3-2-7(12)5-9(8)13-10/h2-5,13H,1H3 |
| InChIKey | NXAULFVCTCPWOF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |