C16H28N2O6 — CID 121385828
ethyl 3-hydroxy-3-methyl-2-[[3-methyl-2-(prop-2-enoxycarbonylamino)butanoyl]amino]butanoate (PubChem CID 121385828) has the molecular formula C16H28N2O6 and a molecular weight of 344.41 g/mol. Its IUPAC name is ethyl 3-hydroxy-3-methyl-2-[[3-methyl-2-(prop-2-enoxycarbonylamino)butanoyl]amino]butanoate.
| Compound Name | ethyl 3-hydroxy-3-methyl-2-[[3-methyl-2-(prop-2-enoxycarbonylamino)butanoyl]amino]butanoate |
|---|---|
| PubChem CID | 121385828 |
| Molecular Formula | C16H28N2O6 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | ethyl 3-hydroxy-3-methyl-2-[[3-methyl-2-(prop-2-enoxycarbonylamino)butanoyl]amino]butanoate |
| SMILES | C=CCOC(=O)NC(C(=O)NC(C(=O)OCC)C(C)(C)O)C(C)C |
| InChI | InChI=1S/C16H28N2O6/c1-7-9-24-15(21)17-11(10(3)4)13(19)18-12(16(5,6)22)14(20)23-8-2/h7,10-12,22H,1,8-9H2,2-6H3,(H,17,21)(H,18,19) |
| InChIKey | IYLNRMANJIOEON-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|