C19H32N2O7 — CID 164889153
methyl (2S,3R)-2-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-3-prop-2-enoyloxybutanoate (PubChem CID 164889153) has the molecular formula C19H32N2O7 and a molecular weight of 400.47 g/mol. Its IUPAC name is methyl (2S,3R)-2-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-3-prop-2-enoyloxybutanoate.
| Compound Name | methyl (2S,3R)-2-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-3-prop-2-enoyloxybutanoate |
|---|---|
| PubChem CID | 164889153 |
| Molecular Formula | C19H32N2O7 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | methyl (2S,3R)-2-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-3-prop-2-enoyloxybutanoate |
| SMILES | C=CC(=O)O[C@H](C)[C@H](NC(=O)[C@H](CC(C)C)NC(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C19H32N2O7/c1-9-14(22)27-12(4)15(17(24)26-8)21-16(23)13(10-11(2)3)20-18(25)28-19(5,6)7/h9,11-13,15H,1,10H2,2-8H3,(H,20,25)(H,21,23)/t12-,13+,15+/m1/s1 |
| InChIKey | RDIVNVBZMUEFSQ-IPYPFGDCSA-N |
| XLogP | 1.70 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|