C21H37N3O7 — CID 86671352
(2S)-3-methyl-2-[[(2S)-3-methyl-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypropanoyl]amino]butanoyl]amino]butanoic acid (PubChem CID 86671352) has the molecular formula C21H37N3O7 and a molecular weight of 443.54 g/mol. Its IUPAC name is (2S)-3-methyl-2-[[(2S)-3-methyl-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypropanoyl]amino]butanoyl]amino]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[[(2S)-3-methyl-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypropanoyl]amino]butanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 86671352 |
| Molecular Formula | C21H37N3O7 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | (2S)-3-methyl-2-[[(2S)-3-methyl-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypropanoyl]amino]butanoyl]amino]butanoic acid |
| SMILES | C=CCOC[C@H](NC(=O)OC(C)(C)C)C(=O)N[C@H](C(=O)N[C@H](C(=O)O)C(C)C)C(C)C |
| InChI | InChI=1S/C21H37N3O7/c1-9-10-30-11-14(22-20(29)31-21(6,7)8)17(25)23-15(12(2)3)18(26)24-16(13(4)5)19(27)28/h9,12-16H,1,10-11H2,2-8H3,(H,22,29)(H,23,25)(H,24,26)(H,27,28)/t14-,15-,16-/m0/s1 |
| InChIKey | FLSBTRATCKJWNW-JYJNAYRXSA-N |
| XLogP | 1.45 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|