C26H43N3O8 — CID 164668955
[(2S)-3-[(2-methylpropan-2-yl)oxy]-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(2-methylprop-2-enoylamino)hexanoyl]amino]-3-oxopropyl] 2-methylprop-2-enoate (PubChem CID 164668955) has the molecular formula C26H43N3O8 and a molecular weight of 525.64 g/mol. Its IUPAC name is [(2S)-3-[(2-methylpropan-2-yl)oxy]-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(2-methylprop-2-enoylamino)hexanoyl]amino]-3-oxopropyl] 2-methylprop-2-enoate.
| Compound Name | [(2S)-3-[(2-methylpropan-2-yl)oxy]-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(2-methylprop-2-enoylamino)hexanoyl]amino]-3-oxopropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 164668955 |
| Molecular Formula | C26H43N3O8 |
| Molecular Weight | 525.64 g/mol |
| Exact Mass | 525.31 |
| IUPAC Name | [(2S)-3-[(2-methylpropan-2-yl)oxy]-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(2-methylprop-2-enoylamino)hexanoyl]amino]-3-oxopropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)NCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)N[C@@H](COC(=O)C(=C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H43N3O8/c1-16(2)20(30)27-14-12-11-13-18(29-24(34)37-26(8,9)10)21(31)28-19(15-35-22(32)17(3)4)23(33)36-25(5,6)7/h18-19H,1,3,11-15H2,2,4-10H3,(H,27,30)(H,28,31)(H,29,34)/t18-,19-/m0/s1 |
| InChIKey | MYHUWKHTFBKMNS-OALUTQOASA-N |
| XLogP | 2.69 |
| TPSA | 149.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.64 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|