C17H27N3O6 — CID 164671306
(2S)-2-[[(2S)-2-azaniumyl-3-(2-methylprop-2-enoyloxy)propanoyl]amino]-6-(2-methylprop-2-enoylamino)hexanoate (PubChem CID 164671306) has the molecular formula C17H27N3O6 and a molecular weight of 369.42 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-azaniumyl-3-(2-methylprop-2-enoyloxy)propanoyl]amino]-6-(2-methylprop-2-enoylamino)hexanoate.
| Compound Name | (2S)-2-[[(2S)-2-azaniumyl-3-(2-methylprop-2-enoyloxy)propanoyl]amino]-6-(2-methylprop-2-enoylamino)hexanoate |
|---|---|
| PubChem CID | 164671306 |
| Molecular Formula | C17H27N3O6 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (2S)-2-[[(2S)-2-azaniumyl-3-(2-methylprop-2-enoyloxy)propanoyl]amino]-6-(2-methylprop-2-enoylamino)hexanoate |
| SMILES | C=C(C)C(=O)NCCCC[C@H](NC(=O)[C@@H]([NH3+])COC(=O)C(=C)C)C(=O)[O-] |
| InChI | InChI=1S/C17H27N3O6/c1-10(2)14(21)19-8-6-5-7-13(16(23)24)20-15(22)12(18)9-26-17(25)11(3)4/h12-13H,1,3,5-9,18H2,2,4H3,(H,19,21)(H,20,22)(H,23,24)/t12-,13-/m0/s1 |
| InChIKey | LOWCGELNBSCXFX-STQMWFEESA-N |
| XLogP | -2.19 |
| TPSA | 152.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|