C19H32N2O7 — CID 59041184
methyl (2S)-2-[bis(2-ethoxy-2-oxoethyl)amino]-6-(2-methylprop-2-enoylamino)hexanoate (PubChem CID 59041184) has the molecular formula C19H32N2O7 and a molecular weight of 400.47 g/mol. Its IUPAC name is methyl (2S)-2-[bis(2-ethoxy-2-oxoethyl)amino]-6-(2-methylprop-2-enoylamino)hexanoate.
| Compound Name | methyl (2S)-2-[bis(2-ethoxy-2-oxoethyl)amino]-6-(2-methylprop-2-enoylamino)hexanoate |
|---|---|
| PubChem CID | 59041184 |
| Molecular Formula | C19H32N2O7 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | methyl (2S)-2-[bis(2-ethoxy-2-oxoethyl)amino]-6-(2-methylprop-2-enoylamino)hexanoate |
| SMILES | C=C(C)C(=O)NCCCC[C@@H](C(=O)OC)N(CC(=O)OCC)CC(=O)OCC |
| InChI | InChI=1S/C19H32N2O7/c1-6-27-16(22)12-21(13-17(23)28-7-2)15(19(25)26-5)10-8-9-11-20-18(24)14(3)4/h15H,3,6-13H2,1-2,4-5H3,(H,20,24)/t15-/m0/s1 |
| InChIKey | BLYIIXNFJDAJQU-HNNXBMFYSA-N |
| XLogP | 0.82 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|