C21H37N3O6 — CID 164668956
tert-butyl (2S)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-6-(2-methylprop-2-enoylamino)hexanoate (PubChem CID 164668956) has the molecular formula C21H37N3O6 and a molecular weight of 427.54 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-6-(2-methylprop-2-enoylamino)hexanoate.
| Compound Name | tert-butyl (2S)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-6-(2-methylprop-2-enoylamino)hexanoate |
|---|---|
| PubChem CID | 164668956 |
| Molecular Formula | C21H37N3O6 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | tert-butyl (2S)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-6-(2-methylprop-2-enoylamino)hexanoate |
| SMILES | C=C(C)C(=O)NCCCC[C@H](NC(=O)CNC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H37N3O6/c1-14(2)17(26)22-12-10-9-11-15(18(27)29-20(3,4)5)24-16(25)13-23-19(28)30-21(6,7)8/h15H,1,9-13H2,2-8H3,(H,22,26)(H,23,28)(H,24,25)/t15-/m0/s1 |
| InChIKey | XIHZSCIFKBJRAL-HNNXBMFYSA-N |
| XLogP | 2.20 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|