C16H26N2O6 — CID 59064977
prop-2-enyl 2-[[3-methoxy-2-(propanoylamino)propanoyl]amino]-5-oxohexanoate (PubChem CID 59064977) has the molecular formula C16H26N2O6 and a molecular weight of 342.39 g/mol. Its IUPAC name is prop-2-enyl 2-[[3-methoxy-2-(propanoylamino)propanoyl]amino]-5-oxohexanoate.
| Compound Name | prop-2-enyl 2-[[3-methoxy-2-(propanoylamino)propanoyl]amino]-5-oxohexanoate |
|---|---|
| PubChem CID | 59064977 |
| Molecular Formula | C16H26N2O6 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | prop-2-enyl 2-[[3-methoxy-2-(propanoylamino)propanoyl]amino]-5-oxohexanoate |
| SMILES | C=CCOC(=O)C(CCC(C)=O)NC(=O)C(COC)NC(=O)CC |
| InChI | InChI=1S/C16H26N2O6/c1-5-9-24-16(22)12(8-7-11(3)19)18-15(21)13(10-23-4)17-14(20)6-2/h5,12-13H,1,6-10H2,2-4H3,(H,17,20)(H,18,21) |
| InChIKey | DHPYCJWMUDWZJP-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|