About ethane;methane;methyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate
ethane;methane;methyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate (PubChem CID 142989223) has the molecular formula C14H30N2O3
and a molecular weight of 274.40 g/mol. Its IUPAC name is ethane;methane;methyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate.
Molecular Properties
| Compound Name | ethane;methane;methyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate |
| PubChem CID | 142989223 |
| Molecular Formula | C14H30N2O3 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | ethane;methane;methyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate |
| SMILES | C.C=C(C)C(=O)NC(CCCCN)C(=O)OC.CC |
| InChI | InChI=1S/C11H20N2O3.C2H6.CH4/c1-8(2)10(14)13-9(11(15)16-3)6-4-5-7-12;1-2;/h9H,1,4-7,12H2,2-3H3,(H,13,14);1-2H3;1H4 |
| InChIKey | AEZKMUVYVPBMGV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;methane;methyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;methyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate?
The IUPAC name of ethane;methane;methyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate (CID 142989223) is ethane;methane;methyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate.
What is the SMILES notation for ethane;methane;methyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate?
The canonical SMILES for ethane;methane;methyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate is C.C=C(C)C(=O)NC(CCCCN)C(=O)OC.CC.
What is the InChIKey of ethane;methane;methyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate?
The InChIKey is AEZKMUVYVPBMGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O3.C2H6.CH4/c1-8(2)10(14)13-9(11(15)16-3)6-4-5-7-12;1-2;/h9H,1,4-7,12H2,2-3H3,(H,13,14);1-2H3;1H4.
What are the key properties of ethane;methane;methyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate?
ethane;methane;methyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate has a molecular weight of 274.40 g/mol, XLogP of 2.01, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;methyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate is sourced from PubChem (CID 142989223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).