C15H32N2O3 — CID 142989227
ethane;ethyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate;methane (PubChem CID 142989227) has the molecular formula C15H32N2O3 and a molecular weight of 288.43 g/mol. Its IUPAC name is ethane;ethyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate;methane.
| Compound Name | ethane;ethyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate;methane |
|---|---|
| PubChem CID | 142989227 |
| Molecular Formula | C15H32N2O3 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.24 |
| IUPAC Name | ethane;ethyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate;methane |
| SMILES | C.C=C(C)C(=O)NC(CCCCN)C(=O)OCC.CC |
| InChI | InChI=1S/C12H22N2O3.C2H6.CH4/c1-4-17-12(16)10(7-5-6-8-13)14-11(15)9(2)3;1-2;/h10H,2,4-8,13H2,1,3H3,(H,14,15);1-2H3;1H4 |
| InChIKey | KMTXEXQGCSXVBC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|