About ethane;ethyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate;methane
ethane;ethyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate;methane (PubChem CID 142989227) has the molecular formula C15H32N2O3
and a molecular weight of 288.43 g/mol. Its IUPAC name is ethane;ethyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate;methane.
Molecular Properties
| Compound Name | ethane;ethyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate;methane |
| PubChem CID | 142989227 |
| Molecular Formula | C15H32N2O3 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.24 |
| IUPAC Name | ethane;ethyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate;methane |
| SMILES | C.C=C(C)C(=O)NC(CCCCN)C(=O)OCC.CC |
| InChI | InChI=1S/C12H22N2O3.C2H6.CH4/c1-4-17-12(16)10(7-5-6-8-13)14-11(15)9(2)3;1-2;/h10H,2,4-8,13H2,1,3H3,(H,14,15);1-2H3;1H4 |
| InChIKey | KMTXEXQGCSXVBC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate;methane?
The IUPAC name of ethane;ethyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate;methane (CID 142989227) is ethane;ethyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate;methane.
What is the SMILES notation for ethane;ethyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate;methane?
The canonical SMILES for ethane;ethyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate;methane is C.C=C(C)C(=O)NC(CCCCN)C(=O)OCC.CC.
What is the InChIKey of ethane;ethyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate;methane?
The InChIKey is KMTXEXQGCSXVBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O3.C2H6.CH4/c1-4-17-12(16)10(7-5-6-8-13)14-11(15)9(2)3;1-2;/h10H,2,4-8,13H2,1,3H3,(H,14,15);1-2H3;1H4.
What are the key properties of ethane;ethyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate;methane?
ethane;ethyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate;methane has a molecular weight of 288.43 g/mol, XLogP of 2.40, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethyl 6-amino-2-(2-methylprop-2-enoylamino)hexanoate;methane is sourced from PubChem (CID 142989227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).