C15H26N2O5 — CID 154980772
2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]ethyl 2-methylprop-2-enoate (PubChem CID 154980772) has the molecular formula C15H26N2O5 and a molecular weight of 314.38 g/mol. Its IUPAC name is 2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 154980772 |
| Molecular Formula | C15H26N2O5 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)[C@@H](CC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H26N2O5/c1-7-11(17-14(20)22-15(4,5)6)12(18)16-8-9-21-13(19)10(2)3/h11H,2,7-9H2,1,3-6H3,(H,16,18)(H,17,20)/t11-/m1/s1 |
| InChIKey | PXTXKTTWPROZFV-LLVKDONJSA-N |
| XLogP | 1.53 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|