C18H32N2O6 — CID 121380112
ethyl 3-ethyl-3-hydroxy-2-[[3-methyl-2-(prop-2-enoxycarbonylamino)butanoyl]amino]pentanoate (PubChem CID 121380112) has the molecular formula C18H32N2O6 and a molecular weight of 372.46 g/mol. Its IUPAC name is ethyl 3-ethyl-3-hydroxy-2-[[3-methyl-2-(prop-2-enoxycarbonylamino)butanoyl]amino]pentanoate.
| Compound Name | ethyl 3-ethyl-3-hydroxy-2-[[3-methyl-2-(prop-2-enoxycarbonylamino)butanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 121380112 |
| Molecular Formula | C18H32N2O6 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | ethyl 3-ethyl-3-hydroxy-2-[[3-methyl-2-(prop-2-enoxycarbonylamino)butanoyl]amino]pentanoate |
| SMILES | C=CCOC(=O)NC(C(=O)NC(C(=O)OCC)C(O)(CC)CC)C(C)C |
| InChI | InChI=1S/C18H32N2O6/c1-7-11-26-17(23)19-13(12(5)6)15(21)20-14(16(22)25-10-4)18(24,8-2)9-3/h7,12-14,24H,1,8-11H2,2-6H3,(H,19,23)(H,20,21) |
| InChIKey | WSHAHRRZUHLALC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|