C20H35N3O7 — CID 86671353
(2S)-3-methyl-2-[[2-methyl-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypropanoyl]amino]propanoyl]amino]butanoic acid (PubChem CID 86671353) has the molecular formula C20H35N3O7 and a molecular weight of 429.51 g/mol. Its IUPAC name is (2S)-3-methyl-2-[[2-methyl-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypropanoyl]amino]propanoyl]amino]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[[2-methyl-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypropanoyl]amino]propanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 86671353 |
| Molecular Formula | C20H35N3O7 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | (2S)-3-methyl-2-[[2-methyl-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypropanoyl]amino]propanoyl]amino]butanoic acid |
| SMILES | C=CCOC[C@H](NC(=O)OC(C)(C)C)C(=O)NC(C)(C)C(=O)N[C@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C20H35N3O7/c1-9-10-29-11-13(21-18(28)30-19(4,5)6)15(24)23-20(7,8)17(27)22-14(12(2)3)16(25)26/h9,12-14H,1,10-11H2,2-8H3,(H,21,28)(H,22,27)(H,23,24)(H,25,26)/t13-,14-/m0/s1 |
| InChIKey | XDPOVJYXUOHIDU-KBPBESRZSA-N |
| XLogP | 1.20 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|