C14H24N2O6 — CID 86671356
methyl 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypropanoyl]amino]acetate (PubChem CID 86671356) has the molecular formula C14H24N2O6 and a molecular weight of 316.35 g/mol. Its IUPAC name is methyl 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypropanoyl]amino]acetate.
| Compound Name | methyl 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypropanoyl]amino]acetate |
|---|---|
| PubChem CID | 86671356 |
| Molecular Formula | C14H24N2O6 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | methyl 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypropanoyl]amino]acetate |
| SMILES | C=CCOC[C@H](NC(=O)OC(C)(C)C)C(=O)NCC(=O)OC |
| InChI | InChI=1S/C14H24N2O6/c1-6-7-21-9-10(12(18)15-8-11(17)20-5)16-13(19)22-14(2,3)4/h6,10H,1,7-9H2,2-5H3,(H,15,18)(H,16,19)/t10-/m0/s1 |
| InChIKey | FLPPSELVBIZVON-JTQLQIEISA-N |
| XLogP | 0.37 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|