C28H38N4O4 — CID 121389581
[8-[(2S,4S)-4-methoxy-2-methylpiperidin-1-yl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[(2R,5S)-5-propan-2-yloxyoxan-2-yl]methanone (PubChem CID 121389581) has the molecular formula C28H38N4O4 and a molecular weight of 494.64 g/mol. Its IUPAC name is [8-[(2S,4S)-4-methoxy-2-methylpiperidin-1-yl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[(2R,5S)-5-propan-2-yloxyoxan-2-yl]methanone.
| Compound Name | [8-[(2S,4S)-4-methoxy-2-methylpiperidin-1-yl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[(2R,5S)-5-propan-2-yloxyoxan-2-yl]methanone |
|---|---|
| PubChem CID | 121389581 |
| Molecular Formula | C28H38N4O4 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | [8-[(2S,4S)-4-methoxy-2-methylpiperidin-1-yl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[(2R,5S)-5-propan-2-yloxyoxan-2-yl]methanone |
| SMILES | CO[C@H]1CCN(c2ccc3c(c2)N(C(=O)[C@H]2CC[C@H](OC(C)C)CO2)Cc2cccnc2N3)[C@@H](C)C1 |
| InChI | InChI=1S/C28H38N4O4/c1-18(2)36-23-8-10-26(35-17-23)28(33)32-16-20-6-5-12-29-27(20)30-24-9-7-21(15-25(24)32)31-13-11-22(34-4)14-19(31)3/h5-7,9,12,15,18-19,22-23,26H,8,10-11,13-14,16-17H2,1-4H3,(H,29,30)/t19-,22-,23-,26+/m0/s1 |
| InChIKey | UPTUWIZRHPYHAW-RZOLNQLPSA-N |
| XLogP | 4.65 |
| TPSA | 76.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |