C29H35N5O10S — CID 121393605
(Z)-but-2-enedioic acid;[4-[1-[[1-[(3,5-dimethoxyphenyl)methyl]piperidin-4-yl]-methylcarbamoyl]imidazol-4-yl]phenyl] sulfamate (PubChem CID 121393605) has the molecular formula C29H35N5O10S and a molecular weight of 645.69 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;[4-[1-[[1-[(3,5-dimethoxyphenyl)methyl]piperidin-4-yl]-methylcarbamoyl]imidazol-4-yl]phenyl] sulfamate.
| Compound Name | (Z)-but-2-enedioic acid;[4-[1-[[1-[(3,5-dimethoxyphenyl)methyl]piperidin-4-yl]-methylcarbamoyl]imidazol-4-yl]phenyl] sulfamate |
|---|---|
| PubChem CID | 121393605 |
| Molecular Formula | C29H35N5O10S |
| Molecular Weight | 645.69 g/mol |
| Exact Mass | 645.21 |
| IUPAC Name | (Z)-but-2-enedioic acid;[4-[1-[[1-[(3,5-dimethoxyphenyl)methyl]piperidin-4-yl]-methylcarbamoyl]imidazol-4-yl]phenyl] sulfamate |
| SMILES | COc1cc(CN2CCC(N(C)C(=O)n3cnc(-c4ccc(OS(N)(=O)=O)cc4)c3)CC2)cc(OC)c1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C25H31N5O6S.C4H4O4/c1-28(20-8-10-29(11-9-20)15-18-12-22(34-2)14-23(13-18)35-3)25(31)30-16-24(27-17-30)19-4-6-21(7-5-19)36-37(26,32)33;5-3(6)1-2-4(7)8/h4-7,12-14,16-17,20H,8-11,15H2,1-3H3,(H2,26,32,33);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | LGCKDTRFOLPOSU-BTJKTKAUSA-N |
| XLogP | 2.43 |
| TPSA | 203.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.69 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|