C16H22N4OS — CID 121395999
4-[2-(piperazin-1-ylmethyl)thieno[2,3-c]pyridin-7-yl]morpholine (PubChem CID 121395999) has the molecular formula C16H22N4OS and a molecular weight of 318.45 g/mol. Its IUPAC name is 4-[2-(piperazin-1-ylmethyl)thieno[2,3-c]pyridin-7-yl]morpholine.
| Compound Name | 4-[2-(piperazin-1-ylmethyl)thieno[2,3-c]pyridin-7-yl]morpholine |
|---|---|
| PubChem CID | 121395999 |
| Molecular Formula | C16H22N4OS |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 4-[2-(piperazin-1-ylmethyl)thieno[2,3-c]pyridin-7-yl]morpholine |
| SMILES | c1cc2cc(CN3CCNCC3)sc2c(N2CCOCC2)n1 |
| InChI | InChI=1S/C16H22N4OS/c1-2-18-16(20-7-9-21-10-8-20)15-13(1)11-14(22-15)12-19-5-3-17-4-6-19/h1-2,11,17H,3-10,12H2 |
| InChIKey | OXYDNPHJBSHMHH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |