C23H31N5OS2 — CID 145097074
methanethiol;3-[7-morpholin-4-yl-2-(piperazin-1-ylmethyl)thieno[2,3-c]pyridin-5-yl]aniline (PubChem CID 145097074) has the molecular formula C23H31N5OS2 and a molecular weight of 457.67 g/mol. Its IUPAC name is methanethiol;3-[7-morpholin-4-yl-2-(piperazin-1-ylmethyl)thieno[2,3-c]pyridin-5-yl]aniline.
| Compound Name | methanethiol;3-[7-morpholin-4-yl-2-(piperazin-1-ylmethyl)thieno[2,3-c]pyridin-5-yl]aniline |
|---|---|
| PubChem CID | 145097074 |
| Molecular Formula | C23H31N5OS2 |
| Molecular Weight | 457.67 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | methanethiol;3-[7-morpholin-4-yl-2-(piperazin-1-ylmethyl)thieno[2,3-c]pyridin-5-yl]aniline |
| SMILES | CS.Nc1cccc(-c2cc3cc(CN4CCNCC4)sc3c(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C22H27N5OS.CH4S/c23-18-3-1-2-16(12-18)20-14-17-13-19(15-26-6-4-24-5-7-26)29-21(17)22(25-20)27-8-10-28-11-9-27;1-2/h1-3,12-14,24H,4-11,15,23H2;2H,1H3 |
| InChIKey | DOUROWTWBDUGIX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 66.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.67 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|